About 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one
1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one (PubChem CID 71455111) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one |
| PubChem CID | 71455111 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one |
| SMILES | CC1CN(C(=O)C(Cc2ccccc2)c2ccccc2)CCN1C |
| InChI | InChI=1S/C21H26N2O/c1-17-16-23(14-13-22(17)2)21(24)20(19-11-7-4-8-12-19)15-18-9-5-3-6-10-18/h3-12,17,20H,13-16H2,1-2H3 |
| InChIKey | IGHVFLGMYLDPDV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one?
The IUPAC name of 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one (CID 71455111) is 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one.
What is the SMILES notation for 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one?
The canonical SMILES for 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one is CC1CN(C(=O)C(Cc2ccccc2)c2ccccc2)CCN1C.
What is the InChIKey of 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one?
The InChIKey is IGHVFLGMYLDPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O/c1-17-16-23(14-13-22(17)2)21(24)20(19-11-7-4-8-12-19)15-18-9-5-3-6-10-18/h3-12,17,20H,13-16H2,1-2H3.
What are the key properties of 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one?
1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one has a molecular weight of 322.45 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylpiperazin-1-yl)-2,3-diphenylpropan-1-one is sourced from PubChem (CID 71455111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).