C30H52N4O5 — CID 71455164
trans-(6S,9S)-4-(cyclohexylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 71455164) has the molecular formula C30H52N4O5 and a molecular weight of 548.77 g/mol. Its IUPAC name is trans-(6S,9S)-4-(cyclohexylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | trans-(6S,9S)-4-(cyclohexylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 71455164 |
| Molecular Formula | C30H52N4O5 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | trans-(6S,9S)-4-(cyclohexylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H](C)N(C)C(=O)CCN(CC(C)C)C(=O)CN(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C30H52N4O5/c1-6-25(35)15-11-8-12-16-26-30(39)34(20-24-13-9-7-10-14-24)21-28(37)33(19-22(2)3)18-17-27(36)32(5)23(4)29(38)31-26/h22-24,26H,6-21H2,1-5H3,(H,31,38)/t23-,26-/m0/s1 |
| InChIKey | DMMSSGJOGJDYSF-OZXSUGGESA-N |
| XLogP | 3.54 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|