About (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate
(5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate (PubChem CID 71455194) has the molecular formula C20H18N4O9
and a molecular weight of 458.38 g/mol. Its IUPAC name is (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate.
Molecular Properties
| Compound Name | (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate |
| PubChem CID | 71455194 |
| Molecular Formula | C20H18N4O9 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(OCC(CO[N+](=O)[O-])O[N+](=O)[O-])cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H18N4O9/c1-14-11-19(22(21-14)16-5-3-2-4-6-16)32-20(25)15-7-9-17(10-8-15)30-12-18(33-24(28)29)13-31-23(26)27/h2-11,18H,12-13H2,1H3 |
| InChIKey | QKGTWTIAOYBPEL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 158.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate?
The IUPAC name of (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate (CID 71455194) is (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate.
What is the SMILES notation for (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate?
The canonical SMILES for (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate is Cc1cc(OC(=O)c2ccc(OCC(CO[N+](=O)[O-])O[N+](=O)[O-])cc2)n(-c2ccccc2)n1.
What is the InChIKey of (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate?
The InChIKey is QKGTWTIAOYBPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O9/c1-14-11-19(22(21-14)16-5-3-2-4-6-16)32-20(25)15-7-9-17(10-8-15)30-12-18(33-24(28)29)13-31-23(26)27/h2-11,18H,12-13H2,1H3.
What are the key properties of (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate?
(5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate has a molecular weight of 458.38 g/mol, XLogP of 2.56, 11 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-phenylpyrazol-3-yl) 4-(2,3-dinitrooxypropoxy)benzoate is sourced from PubChem (CID 71455194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).