C23H26ClNO3 — CID 71455204
(5aS,7S)-7-[1-[(4-chlorophenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 71455204) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is (5aS,7S)-7-[1-[(4-chlorophenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | (5aS,7S)-7-[1-[(4-chlorophenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 71455204 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (5aS,7S)-7-[1-[(4-chlorophenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CC[C@H](C(C)CNCc3ccc(Cl)cc3)C[C@@H]1O2 |
| InChI | InChI=1S/C23H26ClNO3/c1-14(12-25-13-16-3-7-19(24)8-4-16)17-5-6-18-10-20-22(28-21(18)11-17)9-15(2)27-23(20)26/h3-4,7-10,14,17,21,25H,5-6,11-13H2,1-2H3/t14?,17-,21-/m0/s1 |
| InChIKey | JFXKAKOGDNCJMH-FKQPOWTQSA-N |
| XLogP | 4.97 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |