About 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine
3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine (PubChem CID 71455249) has the molecular formula C23H20N4O
and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine.
Molecular Properties
| Compound Name | 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine |
| PubChem CID | 71455249 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine |
| SMILES | c1ccc(CNc2cc3c(cn2)[nH]c2ccc(NCc4ccco4)cc23)cc1 |
| InChI | InChI=1S/C23H20N4O/c1-2-5-16(6-3-1)13-25-23-12-20-19-11-17(24-14-18-7-4-10-28-18)8-9-21(19)27-22(20)15-26-23/h1-12,15,24,27H,13-14H2,(H,25,26) |
| InChIKey | BZLSEKAUJTUFFB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine?
The IUPAC name of 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine (CID 71455249) is 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine.
What is the SMILES notation for 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine?
The canonical SMILES for 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine is c1ccc(CNc2cc3c(cn2)[nH]c2ccc(NCc4ccco4)cc23)cc1.
What is the InChIKey of 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine?
The InChIKey is BZLSEKAUJTUFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O/c1-2-5-16(6-3-1)13-25-23-12-20-19-11-17(24-14-18-7-4-10-28-18)8-9-21(19)27-22(20)15-26-23/h1-12,15,24,27H,13-14H2,(H,25,26).
What are the key properties of 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine?
3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine has a molecular weight of 368.44 g/mol, XLogP of 5.53, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-benzyl-6-N-(furan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3,6-diamine is sourced from PubChem (CID 71455249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).