C17H17NO4S — CID 71455294
3-[(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (PubChem CID 71455294) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-[(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
| Compound Name | 3-[(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 71455294 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-[(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| SMILES | CC1c2ccccc2CCN1S(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H17NO4S/c1-12-16-8-3-2-5-13(16)9-10-18(12)23(21,22)15-7-4-6-14(11-15)17(19)20/h2-8,11-12H,9-10H2,1H3,(H,19,20) |
| InChIKey | CKYDHLILOOYRDF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |