About 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid
3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (PubChem CID 71455295) has the molecular formula C17H14N2O4S
and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| PubChem CID | 71455295 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| SMILES | N#Cc1ccc2c(c1)CCN(S(=O)(=O)c1cccc(C(=O)O)c1)C2 |
| InChI | InChI=1S/C17H14N2O4S/c18-10-12-4-5-15-11-19(7-6-13(15)8-12)24(22,23)16-3-1-2-14(9-16)17(20)21/h1-5,8-9H,6-7,11H2,(H,20,21) |
| InChIKey | GJAJUPMKLWMKNY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The IUPAC name of 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (CID 71455295) is 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
What is the SMILES notation for 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The canonical SMILES for 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is N#Cc1ccc2c(c1)CCN(S(=O)(=O)c1cccc(C(=O)O)c1)C2.
What is the InChIKey of 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The InChIKey is GJAJUPMKLWMKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4S/c18-10-12-4-5-15-11-19(7-6-13(15)8-12)24(22,23)16-3-1-2-14(9-16)17(20)21/h1-5,8-9H,6-7,11H2,(H,20,21).
What are the key properties of 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid has a molecular weight of 342.38 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is sourced from PubChem (CID 71455295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).