C21H41NO5 — CID 71455315
[1-methoxy-3-(octylcarbamoyloxy)propan-2-yl] octanoate (PubChem CID 71455315) has the molecular formula C21H41NO5 and a molecular weight of 387.56 g/mol. Its IUPAC name is [1-methoxy-3-(octylcarbamoyloxy)propan-2-yl] octanoate.
| Compound Name | [1-methoxy-3-(octylcarbamoyloxy)propan-2-yl] octanoate |
|---|---|
| PubChem CID | 71455315 |
| Molecular Formula | C21H41NO5 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | [1-methoxy-3-(octylcarbamoyloxy)propan-2-yl] octanoate |
| SMILES | CCCCCCCCNC(=O)OCC(COC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C21H41NO5/c1-4-6-8-10-12-14-16-22-21(24)26-18-19(17-25-3)27-20(23)15-13-11-9-7-5-2/h19H,4-18H2,1-3H3,(H,22,24) |
| InChIKey | YLIJKRAITGVXRZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|