About (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone
(5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (PubChem CID 71455500) has the molecular formula C11H13ClN2O2
and a molecular weight of 240.69 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
Molecular Properties
| Compound Name | (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| PubChem CID | 71455500 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1C[C@H]2CN[C@@H](C2)C1 |
| InChI | InChI=1S/C11H13ClN2O2/c12-10-2-1-9(16-10)11(15)14-5-7-3-8(6-14)13-4-7/h1-2,7-8,13H,3-6H2/t7-,8+/m1/s1 |
| InChIKey | XLPXWVVFGRJJCY-SFYZADRCSA-N |
| XLogP | 1.37 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The IUPAC name of (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (CID 71455500) is (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
What is the SMILES notation for (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The canonical SMILES for (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is O=C(c1ccc(Cl)o1)N1C[C@H]2CN[C@@H](C2)C1.
What is the InChIKey of (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The InChIKey is XLPXWVVFGRJJCY-SFYZADRCSA-N. The full InChI is InChI=1S/C11H13ClN2O2/c12-10-2-1-9(16-10)11(15)14-5-7-3-8(6-14)13-4-7/h1-2,7-8,13H,3-6H2/t7-,8+/m1/s1.
What are the key properties of (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
(5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone has a molecular weight of 240.69 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorofuran-2-yl)-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is sourced from PubChem (CID 71455500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).