C23H18Cl3N3O2 — CID 71455634
(4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-[4-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanone (PubChem CID 71455634) has the molecular formula C23H18Cl3N3O2 and a molecular weight of 474.78 g/mol. Its IUPAC name is (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-[4-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanone.
| Compound Name | (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-[4-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 71455634 |
| Molecular Formula | C23H18Cl3N3O2 |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-[4-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1cnccc1Oc1cc(Cl)c(Cl)cc1Cl)N1CCN(C2CC2)c2ccccc21 |
| InChI | InChI=1S/C23H18Cl3N3O2/c24-16-11-18(26)22(12-17(16)25)31-21-7-8-27-13-15(21)23(30)29-10-9-28(14-5-6-14)19-3-1-2-4-20(19)29/h1-4,7-8,11-14H,5-6,9-10H2 |
| InChIKey | SLFOKMKKDLQLST-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|