C23H23NO6 — CID 71455642
(NZ)-N-[(1S,14R)-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-ylidene]hydroxylamine (PubChem CID 71455642) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (NZ)-N-[(1S,14R)-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,14R)-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 71455642 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (NZ)-N-[(1S,14R)-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-ylidene]hydroxylamine |
| SMILES | COc1cc2c(cc1OC)[C@@H]1/C(=N/O)c3ccc4c(c3O[C@@H]1CO2)C=CC(C)(C)O4 |
| InChI | InChI=1S/C23H23NO6/c1-23(2)8-7-12-15(30-23)6-5-13-21(24-25)20-14-9-17(26-3)18(27-4)10-16(14)28-11-19(20)29-22(12)13/h5-10,19-20,25H,11H2,1-4H3/b24-21+/t19-,20+/m1/s1 |
| InChIKey | FUYDUSPOCNFDMO-INFINQIGSA-N |
| XLogP | 4.00 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|