About 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid
3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid (PubChem CID 71455662) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid |
| PubChem CID | 71455662 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)CCC1CNc2cc(O)ccc21 |
| InChI | InChI=1S/C11H13NO3/c13-8-2-3-9-7(1-4-11(14)15)6-12-10(9)5-8/h2-3,5,7,12-13H,1,4,6H2,(H,14,15) |
| InChIKey | QNQKOPFJCYVYPF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid?
The IUPAC name of 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid (CID 71455662) is 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid.
What is the SMILES notation for 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid?
The canonical SMILES for 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid is O=C(O)CCC1CNc2cc(O)ccc21.
What is the InChIKey of 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid?
The InChIKey is QNQKOPFJCYVYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-8-2-3-9-7(1-4-11(14)15)6-12-10(9)5-8/h2-3,5,7,12-13H,1,4,6H2,(H,14,15).
What are the key properties of 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid?
3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid has a molecular weight of 207.23 g/mol, XLogP of 1.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-hydroxy-2,3-dihydro-1H-indol-3-yl)propanoic acid is sourced from PubChem (CID 71455662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).