C38H32F4N8O2S — CID 71455739
2-N',5-N'-bis[[1-[(2,4-difluorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide (PubChem CID 71455739) has the molecular formula C38H32F4N8O2S and a molecular weight of 740.79 g/mol. Its IUPAC name is 2-N',5-N'-bis[[1-[(2,4-difluorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide.
| Compound Name | 2-N',5-N'-bis[[1-[(2,4-difluorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide |
|---|---|
| PubChem CID | 71455739 |
| Molecular Formula | C38H32F4N8O2S |
| Molecular Weight | 740.79 g/mol |
| Exact Mass | 740.23 |
| IUPAC Name | 2-N',5-N'-bis[[1-[(2,4-difluorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide |
| SMILES | Cc1c(C(=O)NNCc2nc3ccccc3n2Cc2ccc(F)cc2F)sc(C(=O)NNCc2nc3ccccc3n2Cc2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C38H32F4N8O2S/c1-21-22(2)36(38(52)48-44-18-34-46-30-8-4-6-10-32(30)50(34)20-24-12-14-26(40)16-28(24)42)53-35(21)37(51)47-43-17-33-45-29-7-3-5-9-31(29)49(33)19-23-11-13-25(39)15-27(23)41/h3-16,43-44H,17-20H2,1-2H3,(H,47,51)(H,48,52) |
| InChIKey | KPONOQIAKCXPSZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.79 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|