C27H43N3O7 — CID 71455802
tert-butyl (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoate (PubChem CID 71455802) has the molecular formula C27H43N3O7 and a molecular weight of 521.66 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 71455802 |
| Molecular Formula | C27H43N3O7 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43N3O7/c1-18(2)21(23(32)36-26(3,4)5)30-22(31)20(29-25(34)37-27(6,7)8)15-12-16-28-24(33)35-17-19-13-10-9-11-14-19/h9-11,13-14,18,20-21H,12,15-17H2,1-8H3,(H,28,33)(H,29,34)(H,30,31)/t20-,21-/m0/s1 |
| InChIKey | FNEDPBHDLAPXNV-SFTDATJTSA-N |
| XLogP | 4.07 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|