C18H25N3O4 — CID 71455804
benzyl N-[3-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]propyl]carbamate (PubChem CID 71455804) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is benzyl N-[3-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 71455804 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | benzyl N-[3-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]propyl]carbamate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](CCCNC(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C18H25N3O4/c1-12(2)15-17(23)20-14(16(22)21-15)9-6-10-19-18(24)25-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3,(H,19,24)(H,20,23)(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | WWJBNTAMIRTGME-GJZGRUSLSA-N |
| XLogP | 1.33 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|