About 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene
2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene (PubChem CID 71455845) has the molecular formula C19H18O3S
and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene.
Molecular Properties
| Compound Name | 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
| PubChem CID | 71455845 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
| SMILES | COc1cc(/C=C/c2cc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18O3S/c1-20-16-10-13(11-17(21-2)19(16)22-3)8-9-15-12-14-6-4-5-7-18(14)23-15/h4-12H,1-3H3/b9-8+ |
| InChIKey | ZCDBCYWQRBDFOL-CMDGGOBGSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The IUPAC name of 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene (CID 71455845) is 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene.
What is the SMILES notation for 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The canonical SMILES for 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene is COc1cc(/C=C/c2cc3ccccc3s2)cc(OC)c1OC.
What is the InChIKey of 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The InChIKey is ZCDBCYWQRBDFOL-CMDGGOBGSA-N. The full InChI is InChI=1S/C19H18O3S/c1-20-16-10-13(11-17(21-2)19(16)22-3)8-9-15-12-14-6-4-5-7-18(14)23-15/h4-12H,1-3H3/b9-8+.
What are the key properties of 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene has a molecular weight of 326.42 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene is sourced from PubChem (CID 71455845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).