About methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate
methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate (PubChem CID 71455850) has the molecular formula C29H30N2O2
and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate |
| PubChem CID | 71455850 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H30N2O2/c1-33-27(32)28(24-11-5-2-6-12-24)17-20-31(21-18-28)22-19-29(23-30,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-16H,17-22H2,1H3 |
| InChIKey | PTTHINUSKBXVQQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate?
The IUPAC name of methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate (CID 71455850) is methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate?
The canonical SMILES for methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate is COC(=O)C1(c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate?
The InChIKey is PTTHINUSKBXVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N2O2/c1-33-27(32)28(24-11-5-2-6-12-24)17-20-31(21-18-28)22-19-29(23-30,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-16H,17-22H2,1H3.
What are the key properties of methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate?
methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate has a molecular weight of 438.57 g/mol, XLogP of 5.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate is sourced from PubChem (CID 71455850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).