C25H25N5O2 — CID 71455861
3-(2,2-dimethylpropylamino)-4-[[2-(4-phenylanilino)pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 71455861) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)-4-[[2-(4-phenylanilino)pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2,2-dimethylpropylamino)-4-[[2-(4-phenylanilino)pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 71455861 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)-4-[[2-(4-phenylanilino)pyrimidin-4-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)CNc1c(Nc2ccnc(Nc3ccc(-c4ccccc4)cc3)n2)c(=O)c1=O |
| InChI | InChI=1S/C25H25N5O2/c1-25(2,3)15-27-20-21(23(32)22(20)31)29-19-13-14-26-24(30-19)28-18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-14,27H,15H2,1-3H3,(H2,26,28,29,30) |
| InChIKey | NCBMAIPCPSCCLT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|