About 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide
5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 71455866) has the molecular formula C8H4N4O5S2
and a molecular weight of 300.28 g/mol. Its IUPAC name is 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| PubChem CID | 71455866 |
| Molecular Formula | C8H4N4O5S2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H4N4O5S2/c13-7(4-1-2-5(18-4)11(14)15)10-8-9-3-6(19-8)12(16)17/h1-3H,(H,9,10,13) |
| InChIKey | KPPWPQNDTUMUOJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The IUPAC name of 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide (CID 71455866) is 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide.
What is the SMILES notation for 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The canonical SMILES for 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide is O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc([N+](=O)[O-])s1.
What is the InChIKey of 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The InChIKey is KPPWPQNDTUMUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4O5S2/c13-7(4-1-2-5(18-4)11(14)15)10-8-9-3-6(19-8)12(16)17/h1-3H,(H,9,10,13).
What are the key properties of 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide has a molecular weight of 300.28 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide is sourced from PubChem (CID 71455866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).