About 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one
3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one (PubChem CID 71455999) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one |
| PubChem CID | 71455999 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one |
| SMILES | O=C1OCCC1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H15NO2/c15-13-12(6-8-16-13)14-7-5-10-3-1-2-4-11(10)9-14/h1-4,12H,5-9H2 |
| InChIKey | LHHBGPPQEHOZAG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one?
The IUPAC name of 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one (CID 71455999) is 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one.
What is the SMILES notation for 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one?
The canonical SMILES for 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one is O=C1OCCC1N1CCc2ccccc2C1.
What is the InChIKey of 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one?
The InChIKey is LHHBGPPQEHOZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c15-13-12(6-8-16-13)14-7-5-10-3-1-2-4-11(10)9-14/h1-4,12H,5-9H2.
What are the key properties of 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one?
3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one has a molecular weight of 217.27 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-1H-isoquinolin-2-yl)oxolan-2-one is sourced from PubChem (CID 71455999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).