3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid

C16H12N2O2S — CID 71456020

IUPAC3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid
SMILESNc1nc(-c2ccc(-c3cccc(C(=O)O)c3)cc2)cs1
InChIInChI=1S/C16H12N2O2S/c17-16-18-14(9-21-16)11-6-4-10(5-7-11)12-2-1-3-13(8-12)15(19)20/h1-9H,(H2,17,18)(H,19,20)
InChIKeyRGDZLVNNZIDQHV-UHFFFAOYSA-N
MW296.35 g/mol
LogP3.76
Rot. Bonds3

About 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid

3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid (PubChem CID 71456020) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid.

Molecular Properties

Compound Name3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid
PubChem CID71456020
Molecular FormulaC16H12N2O2S
Molecular Weight296.35 g/mol
Exact Mass296.06
IUPAC Name3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid
SMILESNc1nc(-c2ccc(-c3cccc(C(=O)O)c3)cc2)cs1
InChIInChI=1S/C16H12N2O2S/c17-16-18-14(9-21-16)11-6-4-10(5-7-11)12-2-1-3-13(8-12)15(19)20/h1-9H,(H2,17,18)(H,19,20)
InChIKeyRGDZLVNNZIDQHV-UHFFFAOYSA-N
XLogP3.76
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.35
LogP ≤ 53.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid?
The IUPAC name of 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid (CID 71456020) is 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid.
What is the SMILES notation for 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid?
The canonical SMILES for 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid is Nc1nc(-c2ccc(-c3cccc(C(=O)O)c3)cc2)cs1.
What is the InChIKey of 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid?
The InChIKey is RGDZLVNNZIDQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c17-16-18-14(9-21-16)11-6-4-10(5-7-11)12-2-1-3-13(8-12)15(19)20/h1-9H,(H2,17,18)(H,19,20).
What are the key properties of 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid?
3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid has a molecular weight of 296.35 g/mol, XLogP of 3.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzoic acid is sourced from PubChem (CID 71456020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).