C16H26O5 — CID 71456167
[(1S)-2-hydroxy-1-[(4E)-4-(3-methylbutylidene)-5-oxooxolan-2-yl]ethyl] 3-methylbutanoate (PubChem CID 71456167) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1-[(4E)-4-(3-methylbutylidene)-5-oxooxolan-2-yl]ethyl] 3-methylbutanoate.
| Compound Name | [(1S)-2-hydroxy-1-[(4E)-4-(3-methylbutylidene)-5-oxooxolan-2-yl]ethyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 71456167 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(1S)-2-hydroxy-1-[(4E)-4-(3-methylbutylidene)-5-oxooxolan-2-yl]ethyl] 3-methylbutanoate |
| SMILES | CC(C)C/C=C1\CC([C@H](CO)OC(=O)CC(C)C)OC1=O |
| InChI | InChI=1S/C16H26O5/c1-10(2)5-6-12-8-13(21-16(12)19)14(9-17)20-15(18)7-11(3)4/h6,10-11,13-14,17H,5,7-9H2,1-4H3/b12-6+/t13?,14-/m0/s1 |
| InChIKey | VFZQJDFQMKCYGG-FQTPZGMMSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|