About (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane
(3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane (PubChem CID 71456210) has the molecular formula C20H23NO
and a molecular weight of 293.41 g/mol. Its IUPAC name is (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 71456210 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane |
| SMILES | c1ccc([C@H]2COC3(CCCN[C@H]3c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-3-8-16(9-4-1)18-14-20(22-15-18)12-7-13-21-19(20)17-10-5-2-6-11-17/h1-6,8-11,18-19,21H,7,12-15H2/t18-,19+,20?/m1/s1 |
| InChIKey | WJRYRJACQITXQC-LFPSWIHMSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane?
The IUPAC name of (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane (CID 71456210) is (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane is c1ccc([C@H]2COC3(CCCN[C@H]3c3ccccc3)C2)cc1.
What is the InChIKey of (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane?
The InChIKey is WJRYRJACQITXQC-LFPSWIHMSA-N. The full InChI is InChI=1S/C20H23NO/c1-3-8-16(9-4-1)18-14-20(22-15-18)12-7-13-21-19(20)17-10-5-2-6-11-17/h1-6,8-11,18-19,21H,7,12-15H2/t18-,19+,20?/m1/s1.
What are the key properties of (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane?
(3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane has a molecular weight of 293.41 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,10S)-3,10-diphenyl-1-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 71456210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).