C21H28N4 — CID 71456231
9-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]carbazol-3-amine (PubChem CID 71456231) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is 9-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]carbazol-3-amine.
| Compound Name | 9-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]carbazol-3-amine |
|---|---|
| PubChem CID | 71456231 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 9-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]carbazol-3-amine |
| SMILES | C[C@H]1CN(CCCn2c3ccccc3c3cc(N)ccc32)C[C@H](C)N1 |
| InChI | InChI=1S/C21H28N4/c1-15-13-24(14-16(2)23-15)10-5-11-25-20-7-4-3-6-18(20)19-12-17(22)8-9-21(19)25/h3-4,6-9,12,15-16,23H,5,10-11,13-14,22H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | DAVHXSIZTCBGJE-HOTGVXAUSA-N |
| XLogP | 3.45 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|