C20H24F3N3O4 — CID 71456345
4-(piperidin-4-ylmethyl)-1-prop-2-enyl-3H-1,4-benzodiazepine-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 71456345) has the molecular formula C20H24F3N3O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is 4-(piperidin-4-ylmethyl)-1-prop-2-enyl-3H-1,4-benzodiazepine-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(piperidin-4-ylmethyl)-1-prop-2-enyl-3H-1,4-benzodiazepine-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71456345 |
| Molecular Formula | C20H24F3N3O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-(piperidin-4-ylmethyl)-1-prop-2-enyl-3H-1,4-benzodiazepine-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C(=O)CN(CC2CCNCC2)C(=O)c2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2.C2HF3O2/c1-2-11-21-16-6-4-3-5-15(16)18(23)20(13-17(21)22)12-14-7-9-19-10-8-14;3-2(4,5)1(6)7/h2-6,14,19H,1,7-13H2;(H,6,7) |
| InChIKey | FQFOBYKRNNREMR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|