C24H24F3N5O2 — CID 71456403
5-N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-dicarboxamide (PubChem CID 71456403) has the molecular formula C24H24F3N5O2 and a molecular weight of 471.48 g/mol. Its IUPAC name is 5-N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 71456403 |
| Molecular Formula | C24H24F3N5O2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-2-N-(4,4,4-trifluorobutyl)pyridine-2,5-dicarboxamide |
| SMILES | Cc1ncc(-c2ccccc2CCNC(=O)c2ccc(C(=O)NCCCC(F)(F)F)nc2)cn1 |
| InChI | InChI=1S/C24H24F3N5O2/c1-16-30-14-19(15-31-16)20-6-3-2-5-17(20)9-12-29-22(33)18-7-8-21(32-13-18)23(34)28-11-4-10-24(25,26)27/h2-3,5-8,13-15H,4,9-12H2,1H3,(H,28,34)(H,29,33) |
| InChIKey | QHVBHCXARAVYMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|