About (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate
(2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 71456440) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate |
| PubChem CID | 71456440 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCc1ccccc1COC(=O)c1c(C)nc2cc(C)ccn12 |
| InChI | InChI=1S/C19H20N2O2/c1-4-15-7-5-6-8-16(15)12-23-19(22)18-14(3)20-17-11-13(2)9-10-21(17)18/h5-11H,4,12H2,1-3H3 |
| InChIKey | WQIFCEBSVUDAAW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The IUPAC name of (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CID 71456440) is (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate.
What is the SMILES notation for (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The canonical SMILES for (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate is CCc1ccccc1COC(=O)c1c(C)nc2cc(C)ccn12.
What is the InChIKey of (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The InChIKey is WQIFCEBSVUDAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-4-15-7-5-6-8-16(15)12-23-19(22)18-14(3)20-17-11-13(2)9-10-21(17)18/h5-11H,4,12H2,1-3H3.
What are the key properties of (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
(2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate has a molecular weight of 308.38 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylphenyl)methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate is sourced from PubChem (CID 71456440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).