About methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide
methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide (PubChem CID 71456452) has the molecular formula C12H15BrN2O2S
and a molecular weight of 331.24 g/mol. Its IUPAC name is methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide.
Molecular Properties
| Compound Name | methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide |
| PubChem CID | 71456452 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SC/C(=C\c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C12H14N2O2S.BrH/c1-16-11(15)10(8-17-12(13)14)7-9-5-3-2-4-6-9;/h2-7H,8H2,1H3,(H3,13,14);1H/b10-7+; |
| InChIKey | YYLRAQSEWYYZMB-HCUGZAAXSA-N |
| XLogP | 2.45 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide?
The IUPAC name of methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide (CID 71456452) is methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide.
What is the SMILES notation for methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide?
The canonical SMILES for methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide is Br.[H]/N=C(\N)SC/C(=C\c1ccccc1)C(=O)OC.
What is the InChIKey of methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide?
The InChIKey is YYLRAQSEWYYZMB-HCUGZAAXSA-N. The full InChI is InChI=1S/C12H14N2O2S.BrH/c1-16-11(15)10(8-17-12(13)14)7-9-5-3-2-4-6-9;/h2-7H,8H2,1H3,(H3,13,14);1H/b10-7+;.
What are the key properties of methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide?
methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide has a molecular weight of 331.24 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-phenylprop-2-enoate;hydrobromide is sourced from PubChem (CID 71456452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).