About methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate
methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate (PubChem CID 71456461) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate |
| PubChem CID | 71456461 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccccc1)CS/C(=N/C(C)=O)NC(C)=O |
| InChI | InChI=1S/C16H18N2O4S/c1-11(19)17-16(18-12(2)20)23-10-14(15(21)22-3)9-13-7-5-4-6-8-13/h4-9H,10H2,1-3H3,(H,17,18,19,20)/b14-9+ |
| InChIKey | CPKFMIGIHMPWIK-NTEUORMPSA-N |
| XLogP | 2.01 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate?
The IUPAC name of methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate (CID 71456461) is methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate.
What is the SMILES notation for methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate?
The canonical SMILES for methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate is COC(=O)/C(=C/c1ccccc1)CS/C(=N/C(C)=O)NC(C)=O.
What is the InChIKey of methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate?
The InChIKey is CPKFMIGIHMPWIK-NTEUORMPSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-11(19)17-16(18-12(2)20)23-10-14(15(21)22-3)9-13-7-5-4-6-8-13/h4-9H,10H2,1-3H3,(H,17,18,19,20)/b14-9+.
What are the key properties of methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate?
methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate has a molecular weight of 334.40 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]-3-phenylprop-2-enoate is sourced from PubChem (CID 71456461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).