C27H37N7OS — CID 71456486
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(1,2,4-triazol-1-yl)benzamide (PubChem CID 71456486) has the molecular formula C27H37N7OS and a molecular weight of 507.71 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 71456486 |
| Molecular Formula | C27H37N7OS |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCCN(CCC1CCC(NC(=O)c2cccc(-n3cncn3)c2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C27H37N7OS/c1-2-13-33(22-10-11-24-25(16-22)36-27(28)32-24)14-12-19-6-8-21(9-7-19)31-26(35)20-4-3-5-23(15-20)34-18-29-17-30-34/h3-5,15,17-19,21-22H,2,6-14,16H2,1H3,(H2,28,32)(H,31,35)/t19?,21?,22-/m0/s1 |
| InChIKey | INRXMVVMGAIZEZ-VTLFHKLASA-N |
| XLogP | 4.25 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |