C19H27ClN2O3S — CID 71456570
(2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-cyclohexyl-2-methylpyrrolidine-2-carboxamide (PubChem CID 71456570) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-cyclohexyl-2-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-cyclohexyl-2-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71456570 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-cyclohexyl-2-methylpyrrolidine-2-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCC[C@]1(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H27ClN2O3S/c1-14-16(20)10-6-11-17(14)26(24,25)22-13-7-12-19(22,2)18(23)21-15-8-4-3-5-9-15/h6,10-11,15H,3-5,7-9,12-13H2,1-2H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | WRMNTMIZEUMXFM-LJQANCHMSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |