C23H31ClN2O4 — CID 71456578
2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 71456578) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 71456578 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | CCCC[C@@H]1COC(=O)[C@H](CC(=O)NCc2ccc(Cl)cc2)C/C=C/CCC(=O)N1 |
| InChI | InChI=1S/C23H31ClN2O4/c1-2-3-8-20-16-30-23(29)18(7-5-4-6-9-21(27)26-20)14-22(28)25-15-17-10-12-19(24)13-11-17/h4-5,10-13,18,20H,2-3,6-9,14-16H2,1H3,(H,25,28)(H,26,27)/b5-4+/t18-,20+/m0/s1 |
| InChIKey | ZJNCEHKQJIBTBX-LJGXYGFNSA-N |
| XLogP | 3.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|