C18H16N4O3S — CID 71456636
N-(3,4,5-trimethoxyphenyl)-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 71456636) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N-(3,4,5-trimethoxyphenyl)-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 71456636 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | COc1cc(Nc2ncnc3c2sc2cccnc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N4O3S/c1-23-11-7-10(8-12(24-2)16(11)25-3)22-18-17-15(20-9-21-18)14-13(26-17)5-4-6-19-14/h4-9H,1-3H3,(H,20,21,22) |
| InChIKey | MLGHKWWHCUITRS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |