C22H16F6N4O — CID 71456642
2-[3,4-bis(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole (PubChem CID 71456642) has the molecular formula C22H16F6N4O and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole.
| Compound Name | 2-[3,4-bis(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71456642 |
| Molecular Formula | C22H16F6N4O |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)phenyl]-5-[4-(1,8-naphthyridin-2-yl)butyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2nnc(CCCCc3ccc4cccnc4n3)o2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H16F6N4O/c23-21(24,25)16-10-8-14(12-17(16)22(26,27)28)20-32-31-18(33-20)6-2-1-5-15-9-7-13-4-3-11-29-19(13)30-15/h3-4,7-12H,1-2,5-6H2 |
| InChIKey | DESKZLMQYXSDGI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|