C28H26N2O2 — CID 71456666
1-[(2S,4S)-6-methoxy-2-phenanthren-9-yl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one (PubChem CID 71456666) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[(2S,4S)-6-methoxy-2-phenanthren-9-yl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(2S,4S)-6-methoxy-2-phenanthren-9-yl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71456666 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[(2S,4S)-6-methoxy-2-phenanthren-9-yl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
| SMILES | COc1ccc2c(c1)[C@@H](N1CCCC1=O)C[C@@H](c1cc3ccccc3c3ccccc13)N2 |
| InChI | InChI=1S/C28H26N2O2/c1-32-19-12-13-25-24(16-19)27(30-14-6-11-28(30)31)17-26(29-25)23-15-18-7-2-3-8-20(18)21-9-4-5-10-22(21)23/h2-5,7-10,12-13,15-16,26-27,29H,6,11,14,17H2,1H3/t26-,27-/m0/s1 |
| InChIKey | YQRADZHJGBFHSF-SVBPBHIXSA-N |
| XLogP | 6.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|