C33H41N5O2S — CID 71456683
2-[ethyl-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 71456683) has the molecular formula C33H41N5O2S and a molecular weight of 571.79 g/mol. Its IUPAC name is 2-[ethyl-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[ethyl-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71456683 |
| Molecular Formula | C33H41N5O2S |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 2-[ethyl-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(CCCCCCNc1c2c(nc3ccccc13)CCCC2)CC(=O)Nc1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C33H41N5O2S/c1-3-38(22-31(39)37-33-36-30(23-41-33)24-16-18-25(40-2)19-17-24)21-11-5-4-10-20-34-32-26-12-6-8-14-28(26)35-29-15-9-7-13-27(29)32/h6,8,12,14,16-19,23H,3-5,7,9-11,13,15,20-22H2,1-2H3,(H,34,35)(H,36,37,39) |
| InChIKey | RKXNOCVEXXJMLH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|