About 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide
4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide (PubChem CID 71456695) has the molecular formula C21H16N4O7
and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide |
| PubChem CID | 71456695 |
| Molecular Formula | C21H16N4O7 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N4O7/c1-32-19-11-2-13(20(26)22-14-3-7-16(8-4-14)24(28)29)12-18(19)21(27)23-15-5-9-17(10-6-15)25(30)31/h2-12H,1H3,(H,22,26)(H,23,27) |
| InChIKey | LGDOFYXYYXPILM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide?
The IUPAC name of 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide (CID 71456695) is 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide?
The canonical SMILES for 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide is COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1C(=O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide?
The InChIKey is LGDOFYXYYXPILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O7/c1-32-19-11-2-13(20(26)22-14-3-7-16(8-4-14)24(28)29)12-18(19)21(27)23-15-5-9-17(10-6-15)25(30)31/h2-12H,1H3,(H,22,26)(H,23,27).
What are the key properties of 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide?
4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide has a molecular weight of 436.38 g/mol, XLogP of 4.02, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-N,3-N-bis(4-nitrophenyl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 71456695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).