C16H15F3N2O — CID 71456785
4-(4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazol-3-yl)-3-(trifluoromethyl)benzonitrile (PubChem CID 71456785) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-(4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazol-3-yl)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazol-3-yl)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71456785 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-(4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazol-3-yl)-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C2=NOC3CCCCCC23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N2O/c17-16(18,19)13-8-10(9-20)6-7-11(13)15-12-4-2-1-3-5-14(12)22-21-15/h6-8,12,14H,1-5H2 |
| InChIKey | BCVYSUNPFXKMQP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |