C22H29ClN2O3S — CID 71456882
(2R)-2-[(4-chlorophenyl)sulfonyl-[(4-propan-2-ylphenyl)methyl]amino]-4-methylpentanamide (PubChem CID 71456882) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonyl-[(4-propan-2-ylphenyl)methyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonyl-[(4-propan-2-ylphenyl)methyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 71456882 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonyl-[(4-propan-2-ylphenyl)methyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C(N)=O)N(Cc1ccc(C(C)C)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN2O3S/c1-15(2)13-21(22(24)26)25(14-17-5-7-18(8-6-17)16(3)4)29(27,28)20-11-9-19(23)10-12-20/h5-12,15-16,21H,13-14H2,1-4H3,(H2,24,26)/t21-/m1/s1 |
| InChIKey | COPIVTLAYAMRME-OAQYLSRUSA-N |
| XLogP | 4.55 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |