C20H18BrF3N2O2S — CID 71456944
6-bromo-N,N-dimethyl-9-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-3-amine (PubChem CID 71456944) has the molecular formula C20H18BrF3N2O2S and a molecular weight of 487.34 g/mol. Its IUPAC name is 6-bromo-N,N-dimethyl-9-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-3-amine.
| Compound Name | 6-bromo-N,N-dimethyl-9-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-3-amine |
|---|---|
| PubChem CID | 71456944 |
| Molecular Formula | C20H18BrF3N2O2S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 6-bromo-N,N-dimethyl-9-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-3-amine |
| SMILES | CN(C)C1CCc2c(c3cc(Br)ccc3n2S(=O)(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C20H18BrF3N2O2S/c1-25(2)12-4-7-17-14(10-12)13-9-11(21)3-6-16(13)26(17)29(27,28)18-8-5-15(22)19(23)20(18)24/h3,5-6,8-9,12H,4,7,10H2,1-2H3 |
| InChIKey | BYYSKUBHHAVRPY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|