C26H29ClF3NO2 — CID 71456955
2-[(2S,4R)-1-[(Z,1R)-1-(4-chlorophenyl)-4-methylpent-2-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 71456955) has the molecular formula C26H29ClF3NO2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-[(2S,4R)-1-[(Z,1R)-1-(4-chlorophenyl)-4-methylpent-2-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(2S,4R)-1-[(Z,1R)-1-(4-chlorophenyl)-4-methylpent-2-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 71456955 |
| Molecular Formula | C26H29ClF3NO2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[(2S,4R)-1-[(Z,1R)-1-(4-chlorophenyl)-4-methylpent-2-enyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)/C=C\[C@H](c1ccc(Cl)cc1)N1CC[C@@H](CC(=O)O)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29ClF3NO2/c1-17(2)3-12-23(19-6-10-22(27)11-7-19)31-14-13-18(16-25(32)33)15-24(31)20-4-8-21(9-5-20)26(28,29)30/h3-12,17-18,23-24H,13-16H2,1-2H3,(H,32,33)/b12-3-/t18-,23-,24+/m1/s1 |
| InChIKey | QKNOOOPWQYWKGA-RPBCGYHFSA-N |
| XLogP | 7.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|