C31H48N4O5 — CID 71456965
trans-(6S,9S)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-4-(2-phenylethyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 71456965) has the molecular formula C31H48N4O5 and a molecular weight of 556.75 g/mol. Its IUPAC name is trans-(6S,9S)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-4-(2-phenylethyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | trans-(6S,9S)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-4-(2-phenylethyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 71456965 |
| Molecular Formula | C31H48N4O5 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | trans-(6S,9S)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-4-(2-phenylethyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H](C)N(C)C(=O)CCN(CC(C)C)C(=O)CN(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C31H48N4O5/c1-6-26(36)15-11-8-12-16-27-31(40)35(19-17-25-13-9-7-10-14-25)22-29(38)34(21-23(2)3)20-18-28(37)33(5)24(4)30(39)32-27/h7,9-10,13-14,23-24,27H,6,8,11-12,15-22H2,1-5H3,(H,32,39)/t24-,27-/m0/s1 |
| InChIKey | REIROTLQERSECT-IGKIAQTJSA-N |
| XLogP | 3.21 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|