C25H19ClFNO4 — CID 71457000
ethyl 2-[3-(2-chlorophenyl)phenyl]-6-fluoro-7-methoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 71457000) has the molecular formula C25H19ClFNO4 and a molecular weight of 451.88 g/mol. Its IUPAC name is ethyl 2-[3-(2-chlorophenyl)phenyl]-6-fluoro-7-methoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-[3-(2-chlorophenyl)phenyl]-6-fluoro-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71457000 |
| Molecular Formula | C25H19ClFNO4 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | ethyl 2-[3-(2-chlorophenyl)phenyl]-6-fluoro-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc(-c3ccccc3Cl)c2)[nH]c2cc(OC)c(F)cc2c1=O |
| InChI | InChI=1S/C25H19ClFNO4/c1-3-32-25(30)22-23(28-20-13-21(31-2)19(27)12-17(20)24(22)29)15-8-6-7-14(11-15)16-9-4-5-10-18(16)26/h4-13H,3H2,1-2H3,(H,28,29) |
| InChIKey | UKGOAEGTOJGOKO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |