C21H21Cl2N5O4S2 — CID 71457169
N-[N'-[[3,5-dichloro-4-(methanesulfonamido)phenyl]methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carboxamide (PubChem CID 71457169) has the molecular formula C21H21Cl2N5O4S2 and a molecular weight of 542.47 g/mol. Its IUPAC name is N-[N'-[[3,5-dichloro-4-(methanesulfonamido)phenyl]methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carboxamide.
| Compound Name | N-[N'-[[3,5-dichloro-4-(methanesulfonamido)phenyl]methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71457169 |
| Molecular Formula | C21H21Cl2N5O4S2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | N-[N'-[[3,5-dichloro-4-(methanesulfonamido)phenyl]methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carboxamide |
| SMILES | COc1ccc(-c2nsc(C)c2C(=O)N/C(N)=N/Cc2cc(Cl)c(NS(C)(=O)=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H21Cl2N5O4S2/c1-11-17(18(27-33-11)13-4-6-14(32-2)7-5-13)20(29)26-21(24)25-10-12-8-15(22)19(16(23)9-12)28-34(3,30)31/h4-9,28H,10H2,1-3H3,(H3,24,25,26,29) |
| InChIKey | KUGXCHPMNPXDGL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|