C20H23N3O5S — CID 71457191
3,4-dimethyl-7-[[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one (PubChem CID 71457191) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3,4-dimethyl-7-[[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one.
| Compound Name | 3,4-dimethyl-7-[[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 71457191 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3,4-dimethyl-7-[[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCc3nnc(SCCN4CCOCC4)o3)cc2oc1=O |
| InChI | InChI=1S/C20H23N3O5S/c1-13-14(2)19(24)27-17-11-15(3-4-16(13)17)26-12-18-21-22-20(28-18)29-10-7-23-5-8-25-9-6-23/h3-4,11H,5-10,12H2,1-2H3 |
| InChIKey | FQNLREZCRMGMJV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|