About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate (PubChem CID 71457230) has the molecular formula C11H22O6
and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate |
| PubChem CID | 71457230 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C11H22O6/c1-3-10(12)11(13)17-9-8-16-7-6-15-5-4-14-2/h10,12H,3-9H2,1-2H3 |
| InChIKey | NGXUMZMSRATYNK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate (CID 71457230) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate is CCC(O)C(=O)OCCOCCOCCOC.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate?
The InChIKey is NGXUMZMSRATYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O6/c1-3-10(12)11(13)17-9-8-16-7-6-15-5-4-14-2/h10,12H,3-9H2,1-2H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate has a molecular weight of 250.29 g/mol, XLogP of -0.02, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-hydroxybutanoate is sourced from PubChem (CID 71457230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).