C25H32O3 — CID 71457257
(6R,8R,9S,10R,13S,14S)-6-hex-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 71457257) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S)-6-hex-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10R,13S,14S)-6-hex-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 71457257 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S)-6-hex-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCCC#CCO[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C25H32O3/c1-4-5-6-7-14-28-22-16-18-19-8-9-23(27)25(19,3)13-11-20(18)24(2)12-10-17(26)15-21(22)24/h10,12,15,18-20,22H,4-5,8-9,11,13-14,16H2,1-3H3/t18-,19-,20-,22+,24+,25-/m0/s1 |
| InChIKey | UEXJOVAPPMYIFD-WIFUEDSZSA-N |
| XLogP | 4.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|