About 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol
4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol (PubChem CID 71457266) has the molecular formula C25H22FNO3
and a molecular weight of 403.45 g/mol. Its IUPAC name is 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol.
Molecular Properties
| Compound Name | 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol |
| PubChem CID | 71457266 |
| Molecular Formula | C25H22FNO3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol |
| SMILES | CCCn1c(-c2ccc(O)cc2F)cc(-c2ccc(O)cc2)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C25H22FNO3/c1-2-13-27-24(21-12-11-20(30)14-23(21)26)15-22(16-3-7-18(28)8-4-16)25(27)17-5-9-19(29)10-6-17/h3-12,14-15,28-30H,2,13H2,1H3 |
| InChIKey | CNZKBSAJCJTNDZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol?
The IUPAC name of 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol (CID 71457266) is 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol.
What is the SMILES notation for 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol?
The canonical SMILES for 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol is CCCn1c(-c2ccc(O)cc2F)cc(-c2ccc(O)cc2)c1-c1ccc(O)cc1.
What is the InChIKey of 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol?
The InChIKey is CNZKBSAJCJTNDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22FNO3/c1-2-13-27-24(21-12-11-20(30)14-23(21)26)15-22(16-3-7-18(28)8-4-16)25(27)17-5-9-19(29)10-6-17/h3-12,14-15,28-30H,2,13H2,1H3.
What are the key properties of 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol?
4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol has a molecular weight of 403.45 g/mol, XLogP of 6.16, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-bis(4-hydroxyphenyl)-1-propylpyrrol-2-yl]-3-fluorophenol is sourced from PubChem (CID 71457266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).