C12H25FN2O3S — CID 71457379
(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentane-1-sulfonyl fluoride (PubChem CID 71457379) has the molecular formula C12H25FN2O3S and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentane-1-sulfonyl fluoride.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 71457379 |
| Molecular Formula | C12H25FN2O3S |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentane-1-sulfonyl fluoride |
| SMILES | CC(C)C[C@@H](CS(=O)(=O)F)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C12H25FN2O3S/c1-8(2)5-10(7-19(13,17)18)15-12(16)11(14)6-9(3)4/h8-11H,5-7,14H2,1-4H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | HBFLDGSYIFJKIR-QWRGUYRKSA-N |
| XLogP | 1.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |