About 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine
7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine (PubChem CID 71457409) has the molecular formula C21H24IN3O
and a molecular weight of 461.35 g/mol. Its IUPAC name is 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine.
Molecular Properties
| Compound Name | 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine |
| PubChem CID | 71457409 |
| Molecular Formula | C21H24IN3O |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine |
| SMILES | CCCN1CCC(COc2nc3c(I)cccc3c3ncccc23)CC1 |
| InChI | InChI=1S/C21H24IN3O/c1-2-11-25-12-8-15(9-13-25)14-26-21-17-6-4-10-23-19(17)16-5-3-7-18(22)20(16)24-21/h3-7,10,15H,2,8-9,11-14H2,1H3 |
| InChIKey | BIAZRDQNRJRCRQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine?
The IUPAC name of 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine (CID 71457409) is 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine.
What is the SMILES notation for 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine?
The canonical SMILES for 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine is CCCN1CCC(COc2nc3c(I)cccc3c3ncccc23)CC1.
What is the InChIKey of 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine?
The InChIKey is BIAZRDQNRJRCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24IN3O/c1-2-11-25-12-8-15(9-13-25)14-26-21-17-6-4-10-23-19(17)16-5-3-7-18(22)20(16)24-21/h3-7,10,15H,2,8-9,11-14H2,1H3.
What are the key properties of 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine?
7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine has a molecular weight of 461.35 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-5-[(1-propylpiperidin-4-yl)methoxy]benzo[h][1,6]naphthyridine is sourced from PubChem (CID 71457409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).